C22H30BNO5S — CID 166594077
N-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfonamide (PubChem CID 166594077) has the molecular formula C22H30BNO5S and a molecular weight of 431.36 g/mol. Its IUPAC name is N-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfonamide.
| Compound Name | N-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 166594077 |
| Molecular Formula | C22H30BNO5S |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[4-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1ccc(OCc2ccccc2)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H30BNO5S/c1-16(2)30(25,26)24-18-12-13-20(27-15-17-10-8-7-9-11-17)19(14-18)23-28-21(3,4)22(5,6)29-23/h7-14,16,24H,15H2,1-6H3 |
| InChIKey | WMEPAVLVJZDBNL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|