C13H17BClF2NO4S — CID 164655745
N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,1-difluoromethanesulfonamide (PubChem CID 164655745) has the molecular formula C13H17BClF2NO4S and a molecular weight of 367.61 g/mol. Its IUPAC name is N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,1-difluoromethanesulfonamide.
| Compound Name | N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 164655745 |
| Molecular Formula | C13H17BClF2NO4S |
| Molecular Weight | 367.61 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,1-difluoromethanesulfonamide |
| SMILES | CC1(C)OB(c2cc(NS(=O)(=O)C(F)F)ccc2Cl)OC1(C)C |
| InChI | InChI=1S/C13H17BClF2NO4S/c1-12(2)13(3,4)22-14(21-12)9-7-8(5-6-10(9)15)18-23(19,20)11(16)17/h5-7,11,18H,1-4H3 |
| InChIKey | ROCLSRQKNWFMQP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|