C13H17BF3NO4S — CID 164658412
1,1-difluoro-N-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (PubChem CID 164658412) has the molecular formula C13H17BF3NO4S and a molecular weight of 351.16 g/mol. Its IUPAC name is 1,1-difluoro-N-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 164658412 |
| Molecular Formula | C13H17BF3NO4S |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1,1-difluoro-N-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| SMILES | CC1(C)OB(c2cccc(NS(=O)(=O)C(F)F)c2F)OC1(C)C |
| InChI | InChI=1S/C13H17BF3NO4S/c1-12(2)13(3,4)22-14(21-12)8-6-5-7-9(10(8)15)18-23(19,20)11(16)17/h5-7,11,18H,1-4H3 |
| InChIKey | SJONIQKEBNNZIN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|