C15H22BF2NO4S — CID 51034690
N-[2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide (PubChem CID 51034690) has the molecular formula C15H22BF2NO4S and a molecular weight of 361.22 g/mol. Its IUPAC name is N-[2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide.
| Compound Name | N-[2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 51034690 |
| Molecular Formula | C15H22BF2NO4S |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-[2,4-difluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C15H22BF2NO4S/c1-6-9-24(20,21)19-11-8-7-10(17)12(13(11)18)16-22-14(2,3)15(4,5)23-16/h7-8,19H,6,9H2,1-5H3 |
| InChIKey | JKPZNQBOXNCTMJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|