C16H25BClNO5S — CID 153316994
N-[3-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide (PubChem CID 153316994) has the molecular formula C16H25BClNO5S and a molecular weight of 389.71 g/mol. Its IUPAC name is N-[3-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide.
| Compound Name | N-[3-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 153316994 |
| Molecular Formula | C16H25BClNO5S |
| Molecular Weight | 389.71 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[3-chloro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1cc(B2OC(C)(C)C(C)(C)O2)cc(Cl)c1OC |
| InChI | InChI=1S/C16H25BClNO5S/c1-7-8-25(20,21)19-13-10-11(9-12(18)14(13)22-6)17-23-15(2,3)16(4,5)24-17/h9-10,19H,7-8H2,1-6H3 |
| InChIKey | IXKOJYYSUVIHTF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|