C15H25BNO4PS — CID 144731943
N-[2-phosphanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide (PubChem CID 144731943) has the molecular formula C15H25BNO4PS and a molecular weight of 357.22 g/mol. Its IUPAC name is N-[2-phosphanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide.
| Compound Name | N-[2-phosphanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 144731943 |
| Molecular Formula | C15H25BNO4PS |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[2-phosphanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1cccc(B2OC(C)(C)C(C)(C)O2)c1P |
| InChI | InChI=1S/C15H25BNO4PS/c1-6-10-23(18,19)17-12-9-7-8-11(13(12)22)16-20-14(2,3)15(4,5)21-16/h7-9,17H,6,10,22H2,1-5H3 |
| InChIKey | XEEPZJWVZOVLLM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|