C15H23BO6S — CID 175540561
[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy] propane-1-sulfonate (PubChem CID 175540561) has the molecular formula C15H23BO6S and a molecular weight of 342.22 g/mol. Its IUPAC name is [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy] propane-1-sulfonate.
| Compound Name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy] propane-1-sulfonate |
|---|---|
| PubChem CID | 175540561 |
| Molecular Formula | C15H23BO6S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OOc1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H23BO6S/c1-6-11-23(17,18)22-19-13-10-8-7-9-12(13)16-20-14(2,3)15(4,5)21-16/h7-10H,6,11H2,1-5H3 |
| InChIKey | MYSHGRLGSRSAIM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|