C16H26BNO3S — CID 125455206
diethyl-oxo-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imino-λ6-sulfane (PubChem CID 125455206) has the molecular formula C16H26BNO3S and a molecular weight of 323.27 g/mol. Its IUPAC name is diethyl-oxo-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imino-λ6-sulfane.
| Compound Name | diethyl-oxo-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imino-λ6-sulfane |
|---|---|
| PubChem CID | 125455206 |
| Molecular Formula | C16H26BNO3S |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | diethyl-oxo-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imino-λ6-sulfane |
| SMILES | CCS(=O)(CC)=Nc1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H26BNO3S/c1-7-22(19,8-2)18-14-12-10-9-11-13(14)17-20-15(3,4)16(5,6)21-17/h9-12H,7-8H2,1-6H3 |
| InChIKey | AYYUSAAVJHLXKR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|