C15H20BNO2 — CID 123292561
N-[2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (PubChem CID 123292561) has the molecular formula C15H20BNO2 and a molecular weight of 257.14 g/mol. Its IUPAC name is N-[2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine.
| Compound Name | N-[2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 123292561 |
| Molecular Formula | C15H20BNO2 |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[2-ethenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| SMILES | C=Cc1c(N=C)cccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H20BNO2/c1-7-11-12(9-8-10-13(11)17-6)16-18-14(2,3)15(4,5)19-16/h7-10H,1,6H2,2-5H3 |
| InChIKey | RCIHLSXJLYFECM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|