C15H21BFNO4S — CID 140824552
N-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylethenesulfonamide (PubChem CID 140824552) has the molecular formula C15H21BFNO4S and a molecular weight of 341.21 g/mol. Its IUPAC name is N-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylethenesulfonamide.
| Compound Name | N-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylethenesulfonamide |
|---|---|
| PubChem CID | 140824552 |
| Molecular Formula | C15H21BFNO4S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylethenesulfonamide |
| SMILES | C=CS(=O)(=O)N(C)c1cccc(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C15H21BFNO4S/c1-7-23(19,20)18(6)12-10-8-9-11(13(12)17)16-21-14(2,3)15(4,5)22-16/h7-10H,1H2,2-6H3 |
| InChIKey | XRCZFTBPMZKTTL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|