C18H27BFNO3 — CID 140918741
2-fluoro-N-methyl-N-(2-methylpropyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 140918741) has the molecular formula C18H27BFNO3 and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-fluoro-N-methyl-N-(2-methylpropyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 2-fluoro-N-methyl-N-(2-methylpropyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 140918741 |
| Molecular Formula | C18H27BFNO3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-fluoro-N-methyl-N-(2-methylpropyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC(C)CN(C)C(=O)c1cccc(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C18H27BFNO3/c1-12(2)11-21(7)16(22)13-9-8-10-14(15(13)20)19-23-17(3,4)18(5,6)24-19/h8-10,12H,11H2,1-7H3 |
| InChIKey | KNPLJFMOQZUKMN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|