C24H30BFN2O4 — CID 123835673
2-amino-3-fluoro-N-(2-methylpropanoyl)-N-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide (PubChem CID 123835673) has the molecular formula C24H30BFN2O4 and a molecular weight of 440.32 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-(2-methylpropanoyl)-N-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide.
| Compound Name | 2-amino-3-fluoro-N-(2-methylpropanoyl)-N-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 123835673 |
| Molecular Formula | C24H30BFN2O4 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-amino-3-fluoro-N-(2-methylpropanoyl)-N-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cccc1N(C(=O)c1cccc(F)c1N)C(=O)C(C)C |
| InChI | InChI=1S/C24H30BFN2O4/c1-14(2)21(29)28(22(30)16-10-8-12-18(26)20(16)27)19-13-9-11-17(15(19)3)25-31-23(4,5)24(6,7)32-25/h8-14H,27H2,1-7H3 |
| InChIKey | NOJNACHIVUKLFC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|