C26H43BN2O4 — CID 102082053
1-N,1-N,3-N,3-N-tetra(propan-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxamide (PubChem CID 102082053) has the molecular formula C26H43BN2O4 and a molecular weight of 458.45 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetra(propan-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,1-N,3-N,3-N-tetra(propan-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 102082053 |
| Molecular Formula | C26H43BN2O4 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetra(propan-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-dicarboxamide |
| SMILES | CC(C)N(C(=O)c1cccc(C(=O)N(C(C)C)C(C)C)c1B1OC(C)(C)C(C)(C)O1)C(C)C |
| InChI | InChI=1S/C26H43BN2O4/c1-16(2)28(17(3)4)23(30)20-14-13-15-21(24(31)29(18(5)6)19(7)8)22(20)27-32-25(9,10)26(11,12)33-27/h13-19H,1-12H3 |
| InChIKey | QPEWPJZGLNULHY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|