C17H25BO5 — CID 73013106
2-[(2-methylpropan-2-yl)oxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 73013106) has the molecular formula C17H25BO5 and a molecular weight of 320.19 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 73013106 |
| Molecular Formula | C17H25BO5 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC(C)(C)Oc1c(B2OC(C)(C)C(C)(C)O2)cccc1C(=O)O |
| InChI | InChI=1S/C17H25BO5/c1-15(2,3)21-13-11(14(19)20)9-8-10-12(13)18-22-16(4,5)17(6,7)23-18/h8-10H,1-7H3,(H,19,20) |
| InChIKey | MJISZTHQYPECHG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|