About phenyl 2-hydroxybenzoate
phenyl 2-hydroxybenzoate (PubChem CID 8361) has the molecular formula C13H10O3
and a molecular weight of 214.22 g/mol. Its IUPAC name is phenyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | phenyl 2-hydroxybenzoate |
| PubChem CID | 8361 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | phenyl 2-hydroxybenzoate |
| SMILES | O=C(Oc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C13H10O3/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h1-9,14H |
| InChIKey | ZQBAKBUEJOMQEX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-hydroxybenzoate?
The IUPAC name of phenyl 2-hydroxybenzoate (CID 8361) is phenyl 2-hydroxybenzoate.
What is the SMILES notation for phenyl 2-hydroxybenzoate?
The canonical SMILES for phenyl 2-hydroxybenzoate is O=C(Oc1ccccc1)c1ccccc1O.
What is the InChIKey of phenyl 2-hydroxybenzoate?
The InChIKey is ZQBAKBUEJOMQEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h1-9,14H.
What are the key properties of phenyl 2-hydroxybenzoate?
phenyl 2-hydroxybenzoate has a molecular weight of 214.22 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-hydroxybenzoate is sourced from PubChem (CID 8361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).