About Ethyl Salicylate
Ethyl Salicylate (PubChem CID 8365) has the molecular formula C9H10O3
and a molecular weight of 166.17 g/mol. Its IUPAC name is ethyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | Ethyl Salicylate |
| PubChem CID | 8365 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | ethyl 2-hydroxybenzoate |
| SMILES | CCOC(=O)C1=CC=CC=C1O |
| InChI | InChI=1S/C9H10O3/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6,10H,2H2,1H3 |
| InChIKey | GYCKQBWUSACYIF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 156 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Ethyl Salicylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl Salicylate?
The IUPAC name of Ethyl Salicylate (CID 8365) is ethyl 2-hydroxybenzoate.
What is the SMILES notation for Ethyl Salicylate?
The canonical SMILES for Ethyl Salicylate is CCOC(=O)C1=CC=CC=C1O.
What is the InChIKey of Ethyl Salicylate?
The InChIKey is GYCKQBWUSACYIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6,10H,2H2,1H3.
What are the key properties of Ethyl Salicylate?
Ethyl Salicylate has a molecular weight of 166.17 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl Salicylate is sourced from PubChem (CID 8365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).