About propyl 4-hydroxybenzoate
propyl 4-hydroxybenzoate (PubChem CID 7175) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is propyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | propyl 4-hydroxybenzoate |
| PubChem CID | 7175 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | propyl 4-hydroxybenzoate |
| SMILES | CCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O3/c1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3 |
| InChIKey | QELSKZZBTMNZEB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-hydroxybenzoate?
The IUPAC name of propyl 4-hydroxybenzoate (CID 7175) is propyl 4-hydroxybenzoate.
What is the SMILES notation for propyl 4-hydroxybenzoate?
The canonical SMILES for propyl 4-hydroxybenzoate is CCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of propyl 4-hydroxybenzoate?
The InChIKey is QELSKZZBTMNZEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3.
What are the key properties of propyl 4-hydroxybenzoate?
propyl 4-hydroxybenzoate has a molecular weight of 180.20 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-hydroxybenzoate is sourced from PubChem (CID 7175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).