C20H31BO6 — CID 172741642
ethyl 3-(3-methoxy-2-methylpropoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 172741642) has the molecular formula C20H31BO6 and a molecular weight of 378.27 g/mol. Its IUPAC name is ethyl 3-(3-methoxy-2-methylpropoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | ethyl 3-(3-methoxy-2-methylpropoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 172741642 |
| Molecular Formula | C20H31BO6 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | ethyl 3-(3-methoxy-2-methylpropoxy)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CCOC(=O)c1cccc(OCC(C)COC)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H31BO6/c1-8-24-18(22)15-10-9-11-16(25-13-14(2)12-23-7)17(15)21-26-19(3,4)20(5,6)27-21/h9-11,14H,8,12-13H2,1-7H3 |
| InChIKey | JEFXTXNJGYUIGN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|