C19H27BO6 — CID 172711436
methyl 3-[[(2R)-oxolan-2-yl]methoxy]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 172711436) has the molecular formula C19H27BO6 and a molecular weight of 362.23 g/mol. Its IUPAC name is methyl 3-[[(2R)-oxolan-2-yl]methoxy]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | methyl 3-[[(2R)-oxolan-2-yl]methoxy]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 172711436 |
| Molecular Formula | C19H27BO6 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | methyl 3-[[(2R)-oxolan-2-yl]methoxy]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)c1cccc(OC[C@H]2CCCO2)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H27BO6/c1-18(2)19(3,4)26-20(25-18)16-14(17(21)22-5)9-6-10-15(16)24-12-13-8-7-11-23-13/h6,9-10,13H,7-8,11-12H2,1-5H3/t13-/m1/s1 |
| InChIKey | FHMTVBQBSFTEHP-CYBMUJFWSA-N |
| XLogP | 2.33 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|