C15H17NO5 — CID 156790495
2,3-dioxo-N,N-di(propan-2-yl)-1,4-benzodioxine-5-carboxamide (PubChem CID 156790495) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 2,3-dioxo-N,N-di(propan-2-yl)-1,4-benzodioxine-5-carboxamide.
| Compound Name | 2,3-dioxo-N,N-di(propan-2-yl)-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 156790495 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2,3-dioxo-N,N-di(propan-2-yl)-1,4-benzodioxine-5-carboxamide |
| SMILES | CC(C)N(C(=O)c1cccc2oc(=O)c(=O)oc12)C(C)C |
| InChI | InChI=1S/C15H17NO5/c1-8(2)16(9(3)4)13(17)10-6-5-7-11-12(10)21-15(19)14(18)20-11/h5-9H,1-4H3 |
| InChIKey | ZYGQQLCQSQFLAN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|