C17H27NOS — CID 10379661
2-tert-butylsulfanyl-N,N-di(propan-2-yl)benzamide (PubChem CID 10379661) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N,N-di(propan-2-yl)benzamide.
| Compound Name | 2-tert-butylsulfanyl-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 10379661 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2-tert-butylsulfanyl-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccccc1SC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H27NOS/c1-12(2)18(13(3)4)16(19)14-10-8-9-11-15(14)20-17(5,6)7/h8-13H,1-7H3 |
| InChIKey | MRPYEIWUQPYTEH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |