C27H31AgNO3P — CID 56949989
silver;2-diphenylphosphanyl-N,N-di(propan-2-yl)benzamide;acetate (PubChem CID 56949989) has the molecular formula C27H31AgNO3P and a molecular weight of 556.39 g/mol. Its IUPAC name is silver;2-diphenylphosphanyl-N,N-di(propan-2-yl)benzamide;acetate.
| Compound Name | silver;2-diphenylphosphanyl-N,N-di(propan-2-yl)benzamide;acetate |
|---|---|
| PubChem CID | 56949989 |
| Molecular Formula | C27H31AgNO3P |
| Molecular Weight | 556.39 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | silver;2-diphenylphosphanyl-N,N-di(propan-2-yl)benzamide;acetate |
| SMILES | CC(=O)[O-].CC(C)N(C(=O)c1ccccc1P(c1ccccc1)c1ccccc1)C(C)C.[Ag+] |
| InChI | InChI=1S/C25H28NOP.C2H4O2.Ag/c1-19(2)26(20(3)4)25(27)23-17-11-12-18-24(23)28(21-13-7-5-8-14-21)22-15-9-6-10-16-22;1-2(3)4;/h5-20H,1-4H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | WOBRTLCSKLBAAW-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|