C22H22NO2P — CID 149362786
2-diphenylphosphanyl-N-[(2S)-1-hydroxypropan-2-yl]benzamide (PubChem CID 149362786) has the molecular formula C22H22NO2P and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-diphenylphosphanyl-N-[(2S)-1-hydroxypropan-2-yl]benzamide.
| Compound Name | 2-diphenylphosphanyl-N-[(2S)-1-hydroxypropan-2-yl]benzamide |
|---|---|
| PubChem CID | 149362786 |
| Molecular Formula | C22H22NO2P |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-diphenylphosphanyl-N-[(2S)-1-hydroxypropan-2-yl]benzamide |
| SMILES | C[C@@H](CO)NC(=O)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22NO2P/c1-17(16-24)23-22(25)20-14-8-9-15-21(20)26(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15,17,24H,16H2,1H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | YIFVOVNNSYISKK-KRWDZBQOSA-N |
| XLogP | 2.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|