C29H29N2O3PS — CID 101213453
N-[(2S)-1-(benzylsulfamoyl)propan-2-yl]-2-diphenylphosphanylbenzamide (PubChem CID 101213453) has the molecular formula C29H29N2O3PS and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[(2S)-1-(benzylsulfamoyl)propan-2-yl]-2-diphenylphosphanylbenzamide.
| Compound Name | N-[(2S)-1-(benzylsulfamoyl)propan-2-yl]-2-diphenylphosphanylbenzamide |
|---|---|
| PubChem CID | 101213453 |
| Molecular Formula | C29H29N2O3PS |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | N-[(2S)-1-(benzylsulfamoyl)propan-2-yl]-2-diphenylphosphanylbenzamide |
| SMILES | C[C@@H](CS(=O)(=O)NCc1ccccc1)NC(=O)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29N2O3PS/c1-23(22-36(33,34)30-21-24-13-5-2-6-14-24)31-29(32)27-19-11-12-20-28(27)35(25-15-7-3-8-16-25)26-17-9-4-10-18-26/h2-20,23,30H,21-22H2,1H3,(H,31,32)/t23-/m0/s1 |
| InChIKey | RGCUPBWGULXGQI-QHCPKHFHSA-N |
| XLogP | 3.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|