C34H31N2OP — CID 51041221
N-[(2S)-1-anilino-3-phenylpropan-2-yl]-2-diphenylphosphanylbenzamide (PubChem CID 51041221) has the molecular formula C34H31N2OP and a molecular weight of 514.61 g/mol. Its IUPAC name is N-[(2S)-1-anilino-3-phenylpropan-2-yl]-2-diphenylphosphanylbenzamide.
| Compound Name | N-[(2S)-1-anilino-3-phenylpropan-2-yl]-2-diphenylphosphanylbenzamide |
|---|---|
| PubChem CID | 51041221 |
| Molecular Formula | C34H31N2OP |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-[(2S)-1-anilino-3-phenylpropan-2-yl]-2-diphenylphosphanylbenzamide |
| SMILES | O=C(N[C@H](CNc1ccccc1)Cc1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H31N2OP/c37-34(36-29(25-27-15-5-1-6-16-27)26-35-28-17-7-2-8-18-28)32-23-13-14-24-33(32)38(30-19-9-3-10-20-30)31-21-11-4-12-22-31/h1-24,29,35H,25-26H2,(H,36,37)/t29-/m0/s1 |
| InChIKey | KHBBIESNWAREBT-LJAQVGFWSA-N |
| XLogP | 5.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|