C16H16INO2 — CID 6709695
N-(1-hydroxy-3-phenylpropan-2-yl)-2-iodobenzamide (PubChem CID 6709695) has the molecular formula C16H16INO2 and a molecular weight of 381.21 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-2-iodobenzamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 6709695 |
| Molecular Formula | C16H16INO2 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-2-iodobenzamide |
| SMILES | O=C(NC(CO)Cc1ccccc1)c1ccccc1I |
| InChI | InChI=1S/C16H16INO2/c17-15-9-5-4-8-14(15)16(20)18-13(11-19)10-12-6-2-1-3-7-12/h1-9,13,19H,10-11H2,(H,18,20) |
| InChIKey | HVZNNUYJKVVQOQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|