C23H21NO3 — CID 21190791
2-benzoyl-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide (PubChem CID 21190791) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-benzoyl-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide.
| Compound Name | 2-benzoyl-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 21190791 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-benzoyl-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide |
| SMILES | O=C(NC(CO)Cc1ccccc1)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21NO3/c25-16-19(15-17-9-3-1-4-10-17)24-23(27)21-14-8-7-13-20(21)22(26)18-11-5-2-6-12-18/h1-14,19,25H,15-16H2,(H,24,27) |
| InChIKey | YXLXSJYRUHTQAG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |