C16H17NO4 — CID 107861182
3,5-dihydroxy-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]benzamide (PubChem CID 107861182) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 107861182 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3,5-dihydroxy-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](CO)Cc1ccccc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C16H17NO4/c18-10-13(6-11-4-2-1-3-5-11)17-16(21)12-7-14(19)9-15(20)8-12/h1-5,7-9,13,18-20H,6,10H2,(H,17,21)/t13-/m1/s1 |
| InChIKey | FAMRVAPVNVMZRA-CYBMUJFWSA-N |
| XLogP | 1.43 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |