C24H21NO2 — CID 101341857
N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]anthracene-2-carboxamide (PubChem CID 101341857) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]anthracene-2-carboxamide.
| Compound Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]anthracene-2-carboxamide |
|---|---|
| PubChem CID | 101341857 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]anthracene-2-carboxamide |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C24H21NO2/c26-16-23(12-17-6-2-1-3-7-17)25-24(27)21-11-10-20-13-18-8-4-5-9-19(18)14-22(20)15-21/h1-11,13-15,23,26H,12,16H2,(H,25,27)/t23-/m0/s1 |
| InChIKey | WQVHDFKPTUQZSQ-QHCPKHFHSA-N |
| XLogP | 4.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|