C16H15ClFNO2 — CID 82877236
3-chloro-4-fluoro-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide (PubChem CID 82877236) has the molecular formula C16H15ClFNO2 and a molecular weight of 307.75 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide.
| Compound Name | 3-chloro-4-fluoro-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 82877236 |
| Molecular Formula | C16H15ClFNO2 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-chloro-4-fluoro-N-(1-hydroxy-3-phenylpropan-2-yl)benzamide |
| SMILES | O=C(NC(CO)Cc1ccccc1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H15ClFNO2/c17-14-9-12(6-7-15(14)18)16(21)19-13(10-20)8-11-4-2-1-3-5-11/h1-7,9,13,20H,8,10H2,(H,19,21) |
| InChIKey | ZDYYLASPDLOHAH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |