C21H18FNO3 — CID 46884011
(3R)-4-(3-fluorophenyl)-3-(naphthalene-2-carbonylamino)butanoic acid (PubChem CID 46884011) has the molecular formula C21H18FNO3 and a molecular weight of 351.38 g/mol. Its IUPAC name is (3R)-4-(3-fluorophenyl)-3-(naphthalene-2-carbonylamino)butanoic acid.
| Compound Name | (3R)-4-(3-fluorophenyl)-3-(naphthalene-2-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 46884011 |
| Molecular Formula | C21H18FNO3 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (3R)-4-(3-fluorophenyl)-3-(naphthalene-2-carbonylamino)butanoic acid |
| SMILES | O=C(O)C[C@@H](Cc1cccc(F)c1)NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18FNO3/c22-18-7-3-4-14(10-18)11-19(13-20(24)25)23-21(26)17-9-8-15-5-1-2-6-16(15)12-17/h1-10,12,19H,11,13H2,(H,23,26)(H,24,25)/t19-/m1/s1 |
| InChIKey | ZXKHSLXWLSWHDI-LJQANCHMSA-N |
| XLogP | 3.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |