C30H28FNO2 — CID 161200705
N-[(2S)-1-(4-fluorophenyl)-3-oxo-7-phenylheptan-2-yl]naphthalene-2-carboxamide (PubChem CID 161200705) has the molecular formula C30H28FNO2 and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[(2S)-1-(4-fluorophenyl)-3-oxo-7-phenylheptan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(2S)-1-(4-fluorophenyl)-3-oxo-7-phenylheptan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 161200705 |
| Molecular Formula | C30H28FNO2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-[(2S)-1-(4-fluorophenyl)-3-oxo-7-phenylheptan-2-yl]naphthalene-2-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccc(F)cc1)C(=O)CCCCc1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H28FNO2/c31-27-18-14-23(15-19-27)20-28(29(33)13-7-4-10-22-8-2-1-3-9-22)32-30(34)26-17-16-24-11-5-6-12-25(24)21-26/h1-3,5-6,8-9,11-12,14-19,21,28H,4,7,10,13,20H2,(H,32,34)/t28-/m0/s1 |
| InChIKey | UUYBKHVQVLUARR-NDEPHWFRSA-N |
| XLogP | 6.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|