C23H19ClFNO4S — CID 167613833
4-[(3S)-3-[(4-fluorobenzoyl)amino]-2-oxo-4-phenylbutyl]benzenesulfonyl chloride (PubChem CID 167613833) has the molecular formula C23H19ClFNO4S and a molecular weight of 459.93 g/mol. Its IUPAC name is 4-[(3S)-3-[(4-fluorobenzoyl)amino]-2-oxo-4-phenylbutyl]benzenesulfonyl chloride.
| Compound Name | 4-[(3S)-3-[(4-fluorobenzoyl)amino]-2-oxo-4-phenylbutyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 167613833 |
| Molecular Formula | C23H19ClFNO4S |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 4-[(3S)-3-[(4-fluorobenzoyl)amino]-2-oxo-4-phenylbutyl]benzenesulfonyl chloride |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)Cc1ccc(S(=O)(=O)Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19ClFNO4S/c24-31(29,30)20-12-6-17(7-13-20)15-22(27)21(14-16-4-2-1-3-5-16)26-23(28)18-8-10-19(25)11-9-18/h1-13,21H,14-15H2,(H,26,28)/t21-/m0/s1 |
| InChIKey | HJCDMKIYEZYTAS-NRFANRHFSA-N |
| XLogP | 3.91 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |