C20H19FNO5P — CID 46906001
[(2S)-3-(3-fluorophenyl)-2-(naphthalene-2-carbonylamino)propyl] dihydrogen phosphate (PubChem CID 46906001) has the molecular formula C20H19FNO5P and a molecular weight of 403.35 g/mol. Its IUPAC name is [(2S)-3-(3-fluorophenyl)-2-(naphthalene-2-carbonylamino)propyl] dihydrogen phosphate.
| Compound Name | [(2S)-3-(3-fluorophenyl)-2-(naphthalene-2-carbonylamino)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 46906001 |
| Molecular Formula | C20H19FNO5P |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [(2S)-3-(3-fluorophenyl)-2-(naphthalene-2-carbonylamino)propyl] dihydrogen phosphate |
| SMILES | O=C(N[C@H](COP(=O)(O)O)Cc1cccc(F)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H19FNO5P/c21-18-7-3-4-14(10-18)11-19(13-27-28(24,25)26)22-20(23)17-9-8-15-5-1-2-6-16(15)12-17/h1-10,12,19H,11,13H2,(H,22,23)(H2,24,25,26)/t19-/m0/s1 |
| InChIKey | VISSOACZDBUZIC-IBGZPJMESA-N |
| XLogP | 3.43 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|