C15H15FNO4P — CID 100983027
[1-benzamido-2-(3-fluorophenyl)ethyl]phosphonic acid (PubChem CID 100983027) has the molecular formula C15H15FNO4P and a molecular weight of 323.26 g/mol. Its IUPAC name is [1-benzamido-2-(3-fluorophenyl)ethyl]phosphonic acid.
| Compound Name | [1-benzamido-2-(3-fluorophenyl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 100983027 |
| Molecular Formula | C15H15FNO4P |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | [1-benzamido-2-(3-fluorophenyl)ethyl]phosphonic acid |
| SMILES | O=C(NC(Cc1cccc(F)c1)P(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C15H15FNO4P/c16-13-8-4-5-11(9-13)10-14(22(19,20)21)17-15(18)12-6-2-1-3-7-12/h1-9,14H,10H2,(H,17,18)(H2,19,20,21) |
| InChIKey | KETPQLHYNIDPAI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|