C10H13ClNO4P — CID 14210110
[1-[(2-chloroacetyl)amino]-2-phenylethyl]phosphonic acid (PubChem CID 14210110) has the molecular formula C10H13ClNO4P and a molecular weight of 277.64 g/mol. Its IUPAC name is [1-[(2-chloroacetyl)amino]-2-phenylethyl]phosphonic acid.
| Compound Name | [1-[(2-chloroacetyl)amino]-2-phenylethyl]phosphonic acid |
|---|---|
| PubChem CID | 14210110 |
| Molecular Formula | C10H13ClNO4P |
| Molecular Weight | 277.64 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | [1-[(2-chloroacetyl)amino]-2-phenylethyl]phosphonic acid |
| SMILES | O=C(CCl)NC(Cc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C10H13ClNO4P/c11-7-9(13)12-10(17(14,15)16)6-8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,12,13)(H2,14,15,16) |
| InChIKey | ODVLAJPWINLMRZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.64 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|