C14H22ClN2O5P — CID 45261472
[1-[(2-aminoacetyl)amino]-2-phenylethyl]-(3-methoxy-3-oxopropyl)phosphinic acid;hydrochloride (PubChem CID 45261472) has the molecular formula C14H22ClN2O5P and a molecular weight of 364.77 g/mol. Its IUPAC name is [1-[(2-aminoacetyl)amino]-2-phenylethyl]-(3-methoxy-3-oxopropyl)phosphinic acid;hydrochloride.
| Compound Name | [1-[(2-aminoacetyl)amino]-2-phenylethyl]-(3-methoxy-3-oxopropyl)phosphinic acid;hydrochloride |
|---|---|
| PubChem CID | 45261472 |
| Molecular Formula | C14H22ClN2O5P |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [1-[(2-aminoacetyl)amino]-2-phenylethyl]-(3-methoxy-3-oxopropyl)phosphinic acid;hydrochloride |
| SMILES | COC(=O)CCP(=O)(O)C(Cc1ccccc1)NC(=O)CN.Cl |
| InChI | InChI=1S/C14H21N2O5P.ClH/c1-21-14(18)7-8-22(19,20)13(16-12(17)10-15)9-11-5-3-2-4-6-11;/h2-6,13H,7-10,15H2,1H3,(H,16,17)(H,19,20);1H |
| InChIKey | GOAOYFPBTDRALU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|