C22H30NO4P — CID 15696113
N-[1-di(propan-2-yloxy)phosphoryl-2-phenylethyl]-2-phenylacetamide (PubChem CID 15696113) has the molecular formula C22H30NO4P and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[1-di(propan-2-yloxy)phosphoryl-2-phenylethyl]-2-phenylacetamide.
| Compound Name | N-[1-di(propan-2-yloxy)phosphoryl-2-phenylethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 15696113 |
| Molecular Formula | C22H30NO4P |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[1-di(propan-2-yloxy)phosphoryl-2-phenylethyl]-2-phenylacetamide |
| SMILES | CC(C)OP(=O)(OC(C)C)C(Cc1ccccc1)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H30NO4P/c1-17(2)26-28(25,27-18(3)4)22(16-20-13-9-6-10-14-20)23-21(24)15-19-11-7-5-8-12-19/h5-14,17-18,22H,15-16H2,1-4H3,(H,23,24) |
| InChIKey | DDVZEUOZAMWQKR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|