C25H44NO4PS — CID 19737346
N-(1-diethoxyphosphoryl-2-phenylethyl)-11-ethylsulfanylundecanamide (PubChem CID 19737346) has the molecular formula C25H44NO4PS and a molecular weight of 485.67 g/mol. Its IUPAC name is N-(1-diethoxyphosphoryl-2-phenylethyl)-11-ethylsulfanylundecanamide.
| Compound Name | N-(1-diethoxyphosphoryl-2-phenylethyl)-11-ethylsulfanylundecanamide |
|---|---|
| PubChem CID | 19737346 |
| Molecular Formula | C25H44NO4PS |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N-(1-diethoxyphosphoryl-2-phenylethyl)-11-ethylsulfanylundecanamide |
| SMILES | CCOP(=O)(OCC)C(Cc1ccccc1)NC(=O)CCCCCCCCCCSCC |
| InChI | InChI=1S/C25H44NO4PS/c1-4-29-31(28,30-5-2)25(22-23-18-14-13-15-19-23)26-24(27)20-16-11-9-7-8-10-12-17-21-32-6-3/h13-15,18-19,25H,4-12,16-17,20-22H2,1-3H3,(H,26,27) |
| InChIKey | YOOCTPRKUMPZNE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|