C19H31N2O5P — CID 7034746
(2S)-N-[(1R)-1-di(propan-2-yloxy)phosphorylethyl]-2-[(2-phenylacetyl)amino]propanamide (PubChem CID 7034746) has the molecular formula C19H31N2O5P and a molecular weight of 398.44 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-di(propan-2-yloxy)phosphorylethyl]-2-[(2-phenylacetyl)amino]propanamide.
| Compound Name | (2S)-N-[(1R)-1-di(propan-2-yloxy)phosphorylethyl]-2-[(2-phenylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 7034746 |
| Molecular Formula | C19H31N2O5P |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (2S)-N-[(1R)-1-di(propan-2-yloxy)phosphorylethyl]-2-[(2-phenylacetyl)amino]propanamide |
| SMILES | CC(C)OP(=O)(OC(C)C)[C@H](C)NC(=O)[C@H](C)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H31N2O5P/c1-13(2)25-27(24,26-14(3)4)16(6)21-19(23)15(5)20-18(22)12-17-10-8-7-9-11-17/h7-11,13-16H,12H2,1-6H3,(H,20,22)(H,21,23)/t15-,16+/m0/s1 |
| InChIKey | NLFSCYJFOJMESP-JKSUJKDBSA-N |
| XLogP | 3.24 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|