C14H22NO4P — CID 3905845
[4-methyl-2-[(2-phenylacetyl)amino]pentyl]phosphonic acid (PubChem CID 3905845) has the molecular formula C14H22NO4P and a molecular weight of 299.31 g/mol. Its IUPAC name is [4-methyl-2-[(2-phenylacetyl)amino]pentyl]phosphonic acid.
| Compound Name | [4-methyl-2-[(2-phenylacetyl)amino]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 3905845 |
| Molecular Formula | C14H22NO4P |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [4-methyl-2-[(2-phenylacetyl)amino]pentyl]phosphonic acid |
| SMILES | CC(C)CC(CP(=O)(O)O)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H22NO4P/c1-11(2)8-13(10-20(17,18)19)15-14(16)9-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H,15,16)(H2,17,18,19) |
| InChIKey | LRXUEKFGBKFFAF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|