C14H21NO — CID 42561776
N-[(2R)-3,3-dimethylbutan-2-yl]-2-phenylacetamide (PubChem CID 42561776) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethylbutan-2-yl]-2-phenylacetamide.
| Compound Name | N-[(2R)-3,3-dimethylbutan-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 42561776 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-[(2R)-3,3-dimethylbutan-2-yl]-2-phenylacetamide |
| SMILES | C[C@@H](NC(=O)Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C14H21NO/c1-11(14(2,3)4)15-13(16)10-12-8-6-5-7-9-12/h5-9,11H,10H2,1-4H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | OYTAYNCYRSCWOI-LLVKDONJSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |