C10H10Br3NO2 — CID 117066138
2-phenyl-N-(2,2,2-tribromo-1-hydroxyethyl)acetamide (PubChem CID 117066138) has the molecular formula C10H10Br3NO2 and a molecular weight of 415.91 g/mol. Its IUPAC name is 2-phenyl-N-(2,2,2-tribromo-1-hydroxyethyl)acetamide.
| Compound Name | 2-phenyl-N-(2,2,2-tribromo-1-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 117066138 |
| Molecular Formula | C10H10Br3NO2 |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 412.83 |
| IUPAC Name | 2-phenyl-N-(2,2,2-tribromo-1-hydroxyethyl)acetamide |
| SMILES | O=C(Cc1ccccc1)NC(O)C(Br)(Br)Br |
| InChI | InChI=1S/C10H10Br3NO2/c11-10(12,13)9(16)14-8(15)6-7-4-2-1-3-5-7/h1-5,9,16H,6H2,(H,14,15) |
| InChIKey | MUZRLAFTECXJSG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|