C11H13N3O3 — CID 122164047
2-[(2-phenylacetyl)amino]propanediamide (PubChem CID 122164047) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-[(2-phenylacetyl)amino]propanediamide.
| Compound Name | 2-[(2-phenylacetyl)amino]propanediamide |
|---|---|
| PubChem CID | 122164047 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[(2-phenylacetyl)amino]propanediamide |
| SMILES | NC(=O)C(NC(=O)Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C11H13N3O3/c12-10(16)9(11(13)17)14-8(15)6-7-4-2-1-3-5-7/h1-5,9H,6H2,(H2,12,16)(H2,13,17)(H,14,15) |
| InChIKey | ASCNUFZBMWMGMM-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|