C13H15N2NaO4 — CID 23678918
sodium (4S)-5-amino-5-oxo-4-[(2-phenylacetyl)amino]pentanoate (PubChem CID 23678918) has the molecular formula C13H15N2NaO4 and a molecular weight of 286.26 g/mol. Its IUPAC name is sodium (4S)-5-amino-5-oxo-4-[(2-phenylacetyl)amino]pentanoate.
| Compound Name | sodium (4S)-5-amino-5-oxo-4-[(2-phenylacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 23678918 |
| Molecular Formula | C13H15N2NaO4 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | sodium (4S)-5-amino-5-oxo-4-[(2-phenylacetyl)amino]pentanoate |
| SMILES | NC(=O)[C@H](CCC(=O)[O-])NC(=O)Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C13H16N2O4.Na/c14-13(19)10(6-7-12(17)18)15-11(16)8-9-4-2-1-3-5-9;/h1-5,10H,6-8H2,(H2,14,19)(H,15,16)(H,17,18);/q;+1/p-1/t10-;/m0./s1 |
| InChIKey | DTOWEMWBLNFCCM-PPHPATTJSA-M |
| XLogP | -4.27 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |