C18H19N3O3 — CID 31062875
2-(3,3-diphenylpropanoylamino)propanediamide (PubChem CID 31062875) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-(3,3-diphenylpropanoylamino)propanediamide.
| Compound Name | 2-(3,3-diphenylpropanoylamino)propanediamide |
|---|---|
| PubChem CID | 31062875 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-(3,3-diphenylpropanoylamino)propanediamide |
| SMILES | NC(=O)C(NC(=O)CC(c1ccccc1)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C18H19N3O3/c19-17(23)16(18(20)24)21-15(22)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14,16H,11H2,(H2,19,23)(H2,20,24)(H,21,22) |
| InChIKey | LVZSEJDMNZBOEC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|