C16H17NO — CID 46782233
3,3-diphenyl-N-(trideuteriomethyl)propanamide (PubChem CID 46782233) has the molecular formula C16H17NO and a molecular weight of 242.34 g/mol. Its IUPAC name is 3,3-diphenyl-N-(trideuteriomethyl)propanamide.
| Compound Name | 3,3-diphenyl-N-(trideuteriomethyl)propanamide |
|---|---|
| PubChem CID | 46782233 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3,3-diphenyl-N-(trideuteriomethyl)propanamide |
| SMILES | [2H]C([2H])([2H])NC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-17-16(18)12-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3,(H,17,18)/i1D3 |
| InChIKey | DBUBYNLFHWVMRH-FIBGUPNXSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |