C18H19NO3 — CID 174383570
(3,3-diphenylpropanoylamino) propanoate (PubChem CID 174383570) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (3,3-diphenylpropanoylamino) propanoate.
| Compound Name | (3,3-diphenylpropanoylamino) propanoate |
|---|---|
| PubChem CID | 174383570 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (3,3-diphenylpropanoylamino) propanoate |
| SMILES | CCC(=O)ONC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-2-18(21)22-19-17(20)13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16H,2,13H2,1H3,(H,19,20) |
| InChIKey | ZIZFIKXWXSERSM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|