C9H15NO6P2 — CID 87272137
[(2-phenyl-1-phosphonoethyl)amino]methylphosphonic acid (PubChem CID 87272137) has the molecular formula C9H15NO6P2 and a molecular weight of 295.17 g/mol. Its IUPAC name is [(2-phenyl-1-phosphonoethyl)amino]methylphosphonic acid.
| Compound Name | [(2-phenyl-1-phosphonoethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 87272137 |
| Molecular Formula | C9H15NO6P2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | [(2-phenyl-1-phosphonoethyl)amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CNC(Cc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C9H15NO6P2/c11-17(12,13)7-10-9(18(14,15)16)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | PCWQANJEJFKZPG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|