C6H20N2O12P4 — CID 118864879
[[1,4-diphosphono-4-(phosphonomethylamino)butyl]amino]methylphosphonic acid (PubChem CID 118864879) has the molecular formula C6H20N2O12P4 and a molecular weight of 436.12 g/mol. Its IUPAC name is [[1,4-diphosphono-4-(phosphonomethylamino)butyl]amino]methylphosphonic acid.
| Compound Name | [[1,4-diphosphono-4-(phosphonomethylamino)butyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 118864879 |
| Molecular Formula | C6H20N2O12P4 |
| Molecular Weight | 436.12 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | [[1,4-diphosphono-4-(phosphonomethylamino)butyl]amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CNC(CCC(NCP(=O)(O)O)P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H20N2O12P4/c9-21(10,11)3-7-5(23(15,16)17)1-2-6(24(18,19)20)8-4-22(12,13)14/h5-8H,1-4H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | OBMBOBJMIWOTIN-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 254.18 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.12 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|